C11H10IN — CID 143289425
3-iodo-1,6-dimethylisoquinoline (PubChem CID 143289425) has the molecular formula C11H10IN and a molecular weight of 283.11 g/mol. Its IUPAC name is 3-iodo-1,6-dimethylisoquinoline.
| Compound Name | 3-iodo-1,6-dimethylisoquinoline |
|---|---|
| PubChem CID | 143289425 |
| Molecular Formula | C11H10IN |
| Molecular Weight | 283.11 g/mol |
| Exact Mass | 282.99 |
| IUPAC Name | 3-iodo-1,6-dimethylisoquinoline |
| SMILES | Cc1ccc2c(C)nc(I)cc2c1 |
| InChI | InChI=1S/C11H10IN/c1-7-3-4-10-8(2)13-11(12)6-9(10)5-7/h3-6H,1-2H3 |
| InChIKey | GYMJJXIQFQAVET-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.11 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|