About 1,6-dimethylisoquinoline;ethane
1,6-dimethylisoquinoline;ethane (PubChem CID 156751069) has the molecular formula C15H23N
and a molecular weight of 217.36 g/mol. Its IUPAC name is 1,6-dimethylisoquinoline;ethane.
Molecular Properties
| Compound Name | 1,6-dimethylisoquinoline;ethane |
| PubChem CID | 156751069 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 1,6-dimethylisoquinoline;ethane |
| SMILES | CC.CC.Cc1ccc2c(C)nccc2c1 |
| InChI | InChI=1S/C11H11N.2C2H6/c1-8-3-4-11-9(2)12-6-5-10(11)7-8;2*1-2/h3-7H,1-2H3;2*1-2H3 |
| InChIKey | ANAXMHNRUPYWIO-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,6-dimethylisoquinoline;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dimethylisoquinoline;ethane?
The IUPAC name of 1,6-dimethylisoquinoline;ethane (CID 156751069) is 1,6-dimethylisoquinoline;ethane.
What is the SMILES notation for 1,6-dimethylisoquinoline;ethane?
The canonical SMILES for 1,6-dimethylisoquinoline;ethane is CC.CC.Cc1ccc2c(C)nccc2c1.
What is the InChIKey of 1,6-dimethylisoquinoline;ethane?
The InChIKey is ANAXMHNRUPYWIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N.2C2H6/c1-8-3-4-11-9(2)12-6-5-10(11)7-8;2*1-2/h3-7H,1-2H3;2*1-2H3.
What are the key properties of 1,6-dimethylisoquinoline;ethane?
1,6-dimethylisoquinoline;ethane has a molecular weight of 217.36 g/mol, XLogP of 4.90, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dimethylisoquinoline;ethane is sourced from PubChem (CID 156751069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).