About 6,8-dimethylisoquinoline;ethane
6,8-dimethylisoquinoline;ethane (PubChem CID 143881412) has the molecular formula C13H17N
and a molecular weight of 187.29 g/mol. Its IUPAC name is 6,8-dimethylisoquinoline;ethane.
Molecular Properties
| Compound Name | 6,8-dimethylisoquinoline;ethane |
| PubChem CID | 143881412 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 6,8-dimethylisoquinoline;ethane |
| SMILES | CC.Cc1cc(C)c2cnccc2c1 |
| InChI | InChI=1S/C11H11N.C2H6/c1-8-5-9(2)11-7-12-4-3-10(11)6-8;1-2/h3-7H,1-2H3;1-2H3 |
| InChIKey | CPEGFFZIRGNQRG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6,8-dimethylisoquinoline;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dimethylisoquinoline;ethane?
The IUPAC name of 6,8-dimethylisoquinoline;ethane (CID 143881412) is 6,8-dimethylisoquinoline;ethane.
What is the SMILES notation for 6,8-dimethylisoquinoline;ethane?
The canonical SMILES for 6,8-dimethylisoquinoline;ethane is CC.Cc1cc(C)c2cnccc2c1.
What is the InChIKey of 6,8-dimethylisoquinoline;ethane?
The InChIKey is CPEGFFZIRGNQRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N.C2H6/c1-8-5-9(2)11-7-12-4-3-10(11)6-8;1-2/h3-7H,1-2H3;1-2H3.
What are the key properties of 6,8-dimethylisoquinoline;ethane?
6,8-dimethylisoquinoline;ethane has a molecular weight of 187.29 g/mol, XLogP of 3.88, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dimethylisoquinoline;ethane is sourced from PubChem (CID 143881412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).