About ethane;6-methylisoquinoline
ethane;6-methylisoquinoline (PubChem CID 145106291) has the molecular formula C18H33N
and a molecular weight of 263.47 g/mol. Its IUPAC name is ethane;6-methylisoquinoline.
Molecular Properties
| Compound Name | ethane;6-methylisoquinoline |
| PubChem CID | 145106291 |
| Molecular Formula | C18H33N |
| Molecular Weight | 263.47 g/mol |
| Exact Mass | 263.26 |
| IUPAC Name | ethane;6-methylisoquinoline |
| SMILES | CC.CC.CC.CC.Cc1ccc2cnccc2c1 |
| InChI | InChI=1S/C10H9N.4C2H6/c1-8-2-3-10-7-11-5-4-9(10)6-8;4*1-2/h2-7H,1H3;4*1-2H3 |
| InChIKey | SLXNBGGOJGGCSS-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 263.47 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;6-methylisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-methylisoquinoline?
The IUPAC name of ethane;6-methylisoquinoline (CID 145106291) is ethane;6-methylisoquinoline.
What is the SMILES notation for ethane;6-methylisoquinoline?
The canonical SMILES for ethane;6-methylisoquinoline is CC.CC.CC.CC.Cc1ccc2cnccc2c1.
What is the InChIKey of ethane;6-methylisoquinoline?
The InChIKey is SLXNBGGOJGGCSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N.4C2H6/c1-8-2-3-10-7-11-5-4-9(10)6-8;4*1-2/h2-7H,1H3;4*1-2H3.
What are the key properties of ethane;6-methylisoquinoline?
ethane;6-methylisoquinoline has a molecular weight of 263.47 g/mol, XLogP of 6.65, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-methylisoquinoline is sourced from PubChem (CID 145106291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).