C18H18N2 — CID 107037421
N-(isoquinolin-6-ylmethyl)-2,4-dimethylaniline (PubChem CID 107037421) has the molecular formula C18H18N2 and a molecular weight of 262.36 g/mol. Its IUPAC name is N-(isoquinolin-6-ylmethyl)-2,4-dimethylaniline.
| Compound Name | N-(isoquinolin-6-ylmethyl)-2,4-dimethylaniline |
|---|---|
| PubChem CID | 107037421 |
| Molecular Formula | C18H18N2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | N-(isoquinolin-6-ylmethyl)-2,4-dimethylaniline |
| SMILES | Cc1ccc(NCc2ccc3cnccc3c2)c(C)c1 |
| InChI | InChI=1S/C18H18N2/c1-13-3-6-18(14(2)9-13)20-11-15-4-5-17-12-19-8-7-16(17)10-15/h3-10,12,20H,11H2,1-2H3 |
| InChIKey | DSZNZVXANSZWNT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |