C16H12F2N2 — CID 107037597
3,5-difluoro-N-(isoquinolin-6-ylmethyl)aniline (PubChem CID 107037597) has the molecular formula C16H12F2N2 and a molecular weight of 270.28 g/mol. Its IUPAC name is 3,5-difluoro-N-(isoquinolin-6-ylmethyl)aniline.
| Compound Name | 3,5-difluoro-N-(isoquinolin-6-ylmethyl)aniline |
|---|---|
| PubChem CID | 107037597 |
| Molecular Formula | C16H12F2N2 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 3,5-difluoro-N-(isoquinolin-6-ylmethyl)aniline |
| SMILES | Fc1cc(F)cc(NCc2ccc3cnccc3c2)c1 |
| InChI | InChI=1S/C16H12F2N2/c17-14-6-15(18)8-16(7-14)20-9-11-1-2-13-10-19-4-3-12(13)5-11/h1-8,10,20H,9H2 |
| InChIKey | XSVKJXXACYZSCY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |