C16H12Cl2N2O — CID 107679519
2,6-dichloro-4-(isoquinolin-6-ylmethylamino)phenol (PubChem CID 107679519) has the molecular formula C16H12Cl2N2O and a molecular weight of 319.19 g/mol. Its IUPAC name is 2,6-dichloro-4-(isoquinolin-6-ylmethylamino)phenol.
| Compound Name | 2,6-dichloro-4-(isoquinolin-6-ylmethylamino)phenol |
|---|---|
| PubChem CID | 107679519 |
| Molecular Formula | C16H12Cl2N2O |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 2,6-dichloro-4-(isoquinolin-6-ylmethylamino)phenol |
| SMILES | Oc1c(Cl)cc(NCc2ccc3cnccc3c2)cc1Cl |
| InChI | InChI=1S/C16H12Cl2N2O/c17-14-6-13(7-15(18)16(14)21)20-8-10-1-2-12-9-19-4-3-11(12)5-10/h1-7,9,20-21H,8H2 |
| InChIKey | JCYAFVNRYMYZDQ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|