About ethane;6-methylisoquinoline;6-methylquinoline
ethane;6-methylisoquinoline;6-methylquinoline (PubChem CID 142912911) has the molecular formula C22H24N2
and a molecular weight of 316.45 g/mol. Its IUPAC name is ethane;6-methylisoquinoline;6-methylquinoline.
Molecular Properties
| Compound Name | ethane;6-methylisoquinoline;6-methylquinoline |
| PubChem CID | 142912911 |
| Molecular Formula | C22H24N2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | ethane;6-methylisoquinoline;6-methylquinoline |
| SMILES | CC.Cc1ccc2cnccc2c1.Cc1ccc2ncccc2c1 |
| InChI | InChI=1S/2C10H9N.C2H6/c1-8-2-3-10-7-11-5-4-9(10)6-8;1-8-4-5-10-9(7-8)3-2-6-11-10;1-2/h2*2-7H,1H3;1-2H3 |
| InChIKey | AUGFSLJGXYQLIT-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;6-methylisoquinoline;6-methylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-methylisoquinoline;6-methylquinoline?
The IUPAC name of ethane;6-methylisoquinoline;6-methylquinoline (CID 142912911) is ethane;6-methylisoquinoline;6-methylquinoline.
What is the SMILES notation for ethane;6-methylisoquinoline;6-methylquinoline?
The canonical SMILES for ethane;6-methylisoquinoline;6-methylquinoline is CC.Cc1ccc2cnccc2c1.Cc1ccc2ncccc2c1.
What is the InChIKey of ethane;6-methylisoquinoline;6-methylquinoline?
The InChIKey is AUGFSLJGXYQLIT-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H9N.C2H6/c1-8-2-3-10-7-11-5-4-9(10)6-8;1-8-4-5-10-9(7-8)3-2-6-11-10;1-2/h2*2-7H,1H3;1-2H3.
What are the key properties of ethane;6-methylisoquinoline;6-methylquinoline?
ethane;6-methylisoquinoline;6-methylquinoline has a molecular weight of 316.45 g/mol, XLogP of 6.11, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-methylisoquinoline;6-methylquinoline is sourced from PubChem (CID 142912911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).