About ethane;1,7-naphthyridine;quinoline
ethane;1,7-naphthyridine;quinoline (PubChem CID 145375138) has the molecular formula C21H25N3
and a molecular weight of 319.45 g/mol. Its IUPAC name is ethane;1,7-naphthyridine;quinoline.
Molecular Properties
| Compound Name | ethane;1,7-naphthyridine;quinoline |
| PubChem CID | 145375138 |
| Molecular Formula | C21H25N3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | ethane;1,7-naphthyridine;quinoline |
| SMILES | CC.CC.c1ccc2ncccc2c1.c1cnc2cnccc2c1 |
| InChI | InChI=1S/C9H7N.C8H6N2.2C2H6/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-7-3-5-9-6-8(7)10-4-1;2*1-2/h1-7H;1-6H;2*1-2H3 |
| InChIKey | DQGMYAZLRSATHE-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;1,7-naphthyridine;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1,7-naphthyridine;quinoline?
The IUPAC name of ethane;1,7-naphthyridine;quinoline (CID 145375138) is ethane;1,7-naphthyridine;quinoline.
What is the SMILES notation for ethane;1,7-naphthyridine;quinoline?
The canonical SMILES for ethane;1,7-naphthyridine;quinoline is CC.CC.c1ccc2ncccc2c1.c1cnc2cnccc2c1.
What is the InChIKey of ethane;1,7-naphthyridine;quinoline?
The InChIKey is DQGMYAZLRSATHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C8H6N2.2C2H6/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-7-3-5-9-6-8(7)10-4-1;2*1-2/h1-7H;1-6H;2*1-2H3.
What are the key properties of ethane;1,7-naphthyridine;quinoline?
ethane;1,7-naphthyridine;quinoline has a molecular weight of 319.45 g/mol, XLogP of 5.92, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1,7-naphthyridine;quinoline is sourced from PubChem (CID 145375138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).