About 4-methylpyridine;6-methylquinoline
4-methylpyridine;6-methylquinoline (PubChem CID 142243578) has the molecular formula C16H16N2
and a molecular weight of 236.32 g/mol. Its IUPAC name is 4-methylpyridine;6-methylquinoline.
Molecular Properties
| Compound Name | 4-methylpyridine;6-methylquinoline |
| PubChem CID | 142243578 |
| Molecular Formula | C16H16N2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 4-methylpyridine;6-methylquinoline |
| SMILES | Cc1ccc2ncccc2c1.Cc1ccncc1 |
| InChI | InChI=1S/C10H9N.C6H7N/c1-8-4-5-10-9(7-8)3-2-6-11-10;1-6-2-4-7-5-3-6/h2-7H,1H3;2-5H,1H3 |
| InChIKey | SBHBDYAJJROYPA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methylpyridine;6-methylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpyridine;6-methylquinoline?
The IUPAC name of 4-methylpyridine;6-methylquinoline (CID 142243578) is 4-methylpyridine;6-methylquinoline.
What is the SMILES notation for 4-methylpyridine;6-methylquinoline?
The canonical SMILES for 4-methylpyridine;6-methylquinoline is Cc1ccc2ncccc2c1.Cc1ccncc1.
What is the InChIKey of 4-methylpyridine;6-methylquinoline?
The InChIKey is SBHBDYAJJROYPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N.C6H7N/c1-8-4-5-10-9(7-8)3-2-6-11-10;1-6-2-4-7-5-3-6/h2-7H,1H3;2-5H,1H3.
What are the key properties of 4-methylpyridine;6-methylquinoline?
4-methylpyridine;6-methylquinoline has a molecular weight of 236.32 g/mol, XLogP of 3.93, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpyridine;6-methylquinoline is sourced from PubChem (CID 142243578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).