About iodoethane;6-methylquinoline
iodoethane;6-methylquinoline (PubChem CID 160581758) has the molecular formula C12H14IN
and a molecular weight of 299.16 g/mol. Its IUPAC name is iodoethane;6-methylquinoline.
Molecular Properties
| Compound Name | iodoethane;6-methylquinoline |
| PubChem CID | 160581758 |
| Molecular Formula | C12H14IN |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | iodoethane;6-methylquinoline |
| SMILES | CCI.Cc1ccc2ncccc2c1 |
| InChI | InChI=1S/C10H9N.C2H5I/c1-8-4-5-10-9(7-8)3-2-6-11-10;1-2-3/h2-7H,1H3;2H2,1H3 |
| InChIKey | RBWKMBGJNLCNDP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze iodoethane;6-methylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodoethane;6-methylquinoline?
The IUPAC name of iodoethane;6-methylquinoline (CID 160581758) is iodoethane;6-methylquinoline.
What is the SMILES notation for iodoethane;6-methylquinoline?
The canonical SMILES for iodoethane;6-methylquinoline is CCI.Cc1ccc2ncccc2c1.
What is the InChIKey of iodoethane;6-methylquinoline?
The InChIKey is RBWKMBGJNLCNDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N.C2H5I/c1-8-4-5-10-9(7-8)3-2-6-11-10;1-2-3/h2-7H,1H3;2H2,1H3.
What are the key properties of iodoethane;6-methylquinoline?
iodoethane;6-methylquinoline has a molecular weight of 299.16 g/mol, XLogP of 3.98, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for iodoethane;6-methylquinoline is sourced from PubChem (CID 160581758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).