C19H20N2 — CID 63097558
2-(2,5-dimethylphenyl)-1-quinolin-6-ylethanamine (PubChem CID 63097558) has the molecular formula C19H20N2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-1-quinolin-6-ylethanamine.
| Compound Name | 2-(2,5-dimethylphenyl)-1-quinolin-6-ylethanamine |
|---|---|
| PubChem CID | 63097558 |
| Molecular Formula | C19H20N2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-1-quinolin-6-ylethanamine |
| SMILES | Cc1ccc(C)c(CC(N)c2ccc3ncccc3c2)c1 |
| InChI | InChI=1S/C19H20N2/c1-13-5-6-14(2)17(10-13)12-18(20)15-7-8-19-16(11-15)4-3-9-21-19/h3-11,18H,12,20H2,1-2H3 |
| InChIKey | BQHATKBDWDOZDN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |