C17H20N4 — CID 105172407
1-quinolin-6-yl-2-(1,3,5-trimethylpyrazol-4-yl)ethanamine (PubChem CID 105172407) has the molecular formula C17H20N4 and a molecular weight of 280.38 g/mol. Its IUPAC name is 1-quinolin-6-yl-2-(1,3,5-trimethylpyrazol-4-yl)ethanamine.
| Compound Name | 1-quinolin-6-yl-2-(1,3,5-trimethylpyrazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 105172407 |
| Molecular Formula | C17H20N4 |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 1-quinolin-6-yl-2-(1,3,5-trimethylpyrazol-4-yl)ethanamine |
| SMILES | Cc1nn(C)c(C)c1CC(N)c1ccc2ncccc2c1 |
| InChI | InChI=1S/C17H20N4/c1-11-15(12(2)21(3)20-11)10-16(18)13-6-7-17-14(9-13)5-4-8-19-17/h4-9,16H,10,18H2,1-3H3 |
| InChIKey | JFLLRWDRCNCONA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |