C21H28N4 — CID 144598186
ethane;6-methylisoquinoline;4-methyl-1H-pyrazolo[3,4-b]pyridine (PubChem CID 144598186) has the molecular formula C21H28N4 and a molecular weight of 336.48 g/mol. Its IUPAC name is ethane;6-methylisoquinoline;4-methyl-1H-pyrazolo[3,4-b]pyridine.
| Compound Name | ethane;6-methylisoquinoline;4-methyl-1H-pyrazolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 144598186 |
| Molecular Formula | C21H28N4 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | ethane;6-methylisoquinoline;4-methyl-1H-pyrazolo[3,4-b]pyridine |
| SMILES | CC.CC.Cc1ccc2cnccc2c1.Cc1ccnc2[nH]ncc12 |
| InChI | InChI=1S/C10H9N.C7H7N3.2C2H6/c1-8-2-3-10-7-11-5-4-9(10)6-8;1-5-2-3-8-7-6(5)4-9-10-7;2*1-2/h2-7H,1H3;2-4H,1H3,(H,8,9,10);2*1-2H3 |
| InChIKey | LHNBLAFMPXLZHX-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |