C14H9N3 — CID 118510133
3H-indazolo[5,4-g]isoquinoline (PubChem CID 118510133) has the molecular formula C14H9N3 and a molecular weight of 219.25 g/mol. Its IUPAC name is 3H-indazolo[5,4-g]isoquinoline.
| Compound Name | 3H-indazolo[5,4-g]isoquinoline |
|---|---|
| PubChem CID | 118510133 |
| Molecular Formula | C14H9N3 |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 3H-indazolo[5,4-g]isoquinoline |
| SMILES | c1cc2cc3ccc4[nH]ncc4c3cc2cn1 |
| InChI | InChI=1S/C14H9N3/c1-2-14-13(8-16-17-14)12-6-11-7-15-4-3-9(11)5-10(1)12/h1-8H,(H,16,17) |
| InChIKey | DEPSAFPRQPUKFL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|