C7H10N3P — CID 169111634
methylphosphane;1H-pyrazolo[4,5-c]pyridine (PubChem CID 169111634) has the molecular formula C7H10N3P and a molecular weight of 167.15 g/mol. Its IUPAC name is methylphosphane;1H-pyrazolo[4,5-c]pyridine.
| Compound Name | methylphosphane;1H-pyrazolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 169111634 |
| Molecular Formula | C7H10N3P |
| Molecular Weight | 167.15 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | methylphosphane;1H-pyrazolo[4,5-c]pyridine |
| SMILES | CP.c1cc2[nH]ncc2cn1 |
| InChI | InChI=1S/C6H5N3.CH5P/c1-2-7-3-5-4-8-9-6(1)5;1-2/h1-4H,(H,8,9);2H2,1H3 |
| InChIKey | VNWZMSXQDQVOBV-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.15 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|