About 1H-indazole;ruthenium(3+)
1H-indazole;ruthenium(3+) (PubChem CID 158942897) has the molecular formula C7H6N2Ru+3
and a molecular weight of 219.21 g/mol. Its IUPAC name is 1H-indazole;ruthenium(3+).
Molecular Properties
| Compound Name | 1H-indazole;ruthenium(3+) |
| PubChem CID | 158942897 |
| Molecular Formula | C7H6N2Ru+3 |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.96 |
| IUPAC Name | 1H-indazole;ruthenium(3+) |
| SMILES | [Ru+3].c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C7H6N2.Ru/c1-2-4-7-6(3-1)5-8-9-7;/h1-5H,(H,8,9);/q;+3 |
| InChIKey | JKLXXVBBDSJKBC-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-indazole;ruthenium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indazole;ruthenium(3+)?
The IUPAC name of 1H-indazole;ruthenium(3+) (CID 158942897) is 1H-indazole;ruthenium(3+).
What is the SMILES notation for 1H-indazole;ruthenium(3+)?
The canonical SMILES for 1H-indazole;ruthenium(3+) is [Ru+3].c1ccc2[nH]ncc2c1.
What is the InChIKey of 1H-indazole;ruthenium(3+)?
The InChIKey is JKLXXVBBDSJKBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.Ru/c1-2-4-7-6(3-1)5-8-9-7;/h1-5H,(H,8,9);/q;+3.
What are the key properties of 1H-indazole;ruthenium(3+)?
1H-indazole;ruthenium(3+) has a molecular weight of 219.21 g/mol, XLogP of 1.56, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indazole;ruthenium(3+) is sourced from PubChem (CID 158942897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).