About 1H-indazole;hydrate;hydrochloride
1H-indazole;hydrate;hydrochloride (PubChem CID 140981891) has the molecular formula C7H9ClN2O
and a molecular weight of 172.62 g/mol. Its IUPAC name is 1H-indazole;hydrate;hydrochloride.
Molecular Properties
| Compound Name | 1H-indazole;hydrate;hydrochloride |
| PubChem CID | 140981891 |
| Molecular Formula | C7H9ClN2O |
| Molecular Weight | 172.62 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | 1H-indazole;hydrate;hydrochloride |
| SMILES | Cl.O.c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C7H6N2.ClH.H2O/c1-2-4-7-6(3-1)5-8-9-7;;/h1-5H,(H,8,9);1H;1H2 |
| InChIKey | HFROUEBEAIBETQ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.62 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-indazole;hydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indazole;hydrate;hydrochloride?
The IUPAC name of 1H-indazole;hydrate;hydrochloride (CID 140981891) is 1H-indazole;hydrate;hydrochloride.
What is the SMILES notation for 1H-indazole;hydrate;hydrochloride?
The canonical SMILES for 1H-indazole;hydrate;hydrochloride is Cl.O.c1ccc2[nH]ncc2c1.
What is the InChIKey of 1H-indazole;hydrate;hydrochloride?
The InChIKey is HFROUEBEAIBETQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.ClH.H2O/c1-2-4-7-6(3-1)5-8-9-7;;/h1-5H,(H,8,9);1H;1H2.
What are the key properties of 1H-indazole;hydrate;hydrochloride?
1H-indazole;hydrate;hydrochloride has a molecular weight of 172.62 g/mol, XLogP of 1.16, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indazole;hydrate;hydrochloride is sourced from PubChem (CID 140981891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).