About 1-benzofuran;1H-indazole
1-benzofuran;1H-indazole (PubChem CID 121363040) has the molecular formula C15H12N2O
and a molecular weight of 236.27 g/mol. Its IUPAC name is 1-benzofuran;1H-indazole.
Molecular Properties
| Compound Name | 1-benzofuran;1H-indazole |
| PubChem CID | 121363040 |
| Molecular Formula | C15H12N2O |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 1-benzofuran;1H-indazole |
| SMILES | c1ccc2[nH]ncc2c1.c1ccc2occc2c1 |
| InChI | InChI=1S/C8H6O.C7H6N2/c1-2-4-8-7(3-1)5-6-9-8;1-2-4-7-6(3-1)5-8-9-7/h1-6H;1-5H,(H,8,9) |
| InChIKey | WESYVEMPYOUVOP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzofuran;1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzofuran;1H-indazole?
The IUPAC name of 1-benzofuran;1H-indazole (CID 121363040) is 1-benzofuran;1H-indazole.
What is the SMILES notation for 1-benzofuran;1H-indazole?
The canonical SMILES for 1-benzofuran;1H-indazole is c1ccc2[nH]ncc2c1.c1ccc2occc2c1.
What is the InChIKey of 1-benzofuran;1H-indazole?
The InChIKey is WESYVEMPYOUVOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O.C7H6N2/c1-2-4-8-7(3-1)5-6-9-8;1-2-4-7-6(3-1)5-8-9-7/h1-6H;1-5H,(H,8,9).
What are the key properties of 1-benzofuran;1H-indazole?
1-benzofuran;1H-indazole has a molecular weight of 236.27 g/mol, XLogP of 4.00, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzofuran;1H-indazole is sourced from PubChem (CID 121363040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).