About 1H-indazole;thiocarbonyl dichloride
1H-indazole;thiocarbonyl dichloride (PubChem CID 131733696) has the molecular formula C8H6Cl2N2S
and a molecular weight of 233.12 g/mol. Its IUPAC name is 1H-indazole;thiocarbonyl dichloride.
Molecular Properties
| Compound Name | 1H-indazole;thiocarbonyl dichloride |
| PubChem CID | 131733696 |
| Molecular Formula | C8H6Cl2N2S |
| Molecular Weight | 233.12 g/mol |
| Exact Mass | 231.96 |
| IUPAC Name | 1H-indazole;thiocarbonyl dichloride |
| SMILES | S=C(Cl)Cl.c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C7H6N2.CCl2S/c1-2-4-7-6(3-1)5-8-9-7;2-1(3)4/h1-5H,(H,8,9); |
| InChIKey | NJQMTTIDXAWADR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.12 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1H-indazole;thiocarbonyl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indazole;thiocarbonyl dichloride?
The IUPAC name of 1H-indazole;thiocarbonyl dichloride (CID 131733696) is 1H-indazole;thiocarbonyl dichloride.
What is the SMILES notation for 1H-indazole;thiocarbonyl dichloride?
The canonical SMILES for 1H-indazole;thiocarbonyl dichloride is S=C(Cl)Cl.c1ccc2[nH]ncc2c1.
What is the InChIKey of 1H-indazole;thiocarbonyl dichloride?
The InChIKey is NJQMTTIDXAWADR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.CCl2S/c1-2-4-7-6(3-1)5-8-9-7;2-1(3)4/h1-5H,(H,8,9);.
What are the key properties of 1H-indazole;thiocarbonyl dichloride?
1H-indazole;thiocarbonyl dichloride has a molecular weight of 233.12 g/mol, XLogP of 3.31, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indazole;thiocarbonyl dichloride is sourced from PubChem (CID 131733696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).