carbonyl dichloride;1H-indazole

C8H6Cl2N2O — CID 158934789

IUPACcarbonyl dichloride;1H-indazole
SMILESO=C(Cl)Cl.c1ccc2[nH]ncc2c1
InChIInChI=1S/C7H6N2.CCl2O/c1-2-4-7-6(3-1)5-8-9-7;2-1(3)4/h1-5H,(H,8,9);
InChIKeyJJMYSPLONUBAEP-UHFFFAOYSA-N
MW217.06 g/mol
LogP3.15
Rot. Bonds

About carbonyl dichloride;1H-indazole

carbonyl dichloride;1H-indazole (PubChem CID 158934789) has the molecular formula C8H6Cl2N2O and a molecular weight of 217.06 g/mol. Its IUPAC name is carbonyl dichloride;1H-indazole.

Molecular Properties

Compound Namecarbonyl dichloride;1H-indazole
PubChem CID158934789
Molecular FormulaC8H6Cl2N2O
Molecular Weight217.06 g/mol
Exact Mass215.99
IUPAC Namecarbonyl dichloride;1H-indazole
SMILESO=C(Cl)Cl.c1ccc2[nH]ncc2c1
InChIInChI=1S/C7H6N2.CCl2O/c1-2-4-7-6(3-1)5-8-9-7;2-1(3)4/h1-5H,(H,8,9);
InChIKeyJJMYSPLONUBAEP-UHFFFAOYSA-N
XLogP3.15
TPSA45.75 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500217.06
LogP ≤ 53.15
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze carbonyl dichloride;1H-indazole with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbonyl dichloride;1H-indazole?
The IUPAC name of carbonyl dichloride;1H-indazole (CID 158934789) is carbonyl dichloride;1H-indazole.
What is the SMILES notation for carbonyl dichloride;1H-indazole?
The canonical SMILES for carbonyl dichloride;1H-indazole is O=C(Cl)Cl.c1ccc2[nH]ncc2c1.
What is the InChIKey of carbonyl dichloride;1H-indazole?
The InChIKey is JJMYSPLONUBAEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.CCl2O/c1-2-4-7-6(3-1)5-8-9-7;2-1(3)4/h1-5H,(H,8,9);.
What are the key properties of carbonyl dichloride;1H-indazole?
carbonyl dichloride;1H-indazole has a molecular weight of 217.06 g/mol, XLogP of 3.15, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbonyl dichloride;1H-indazole is sourced from PubChem (CID 158934789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).