About 1H-indazole;sulfonylurea
1H-indazole;sulfonylurea (PubChem CID 158433470) has the molecular formula C8H8N4O3S
and a molecular weight of 240.24 g/mol. Its IUPAC name is 1H-indazole;sulfonylurea.
Molecular Properties
| Compound Name | 1H-indazole;sulfonylurea |
| PubChem CID | 158433470 |
| Molecular Formula | C8H8N4O3S |
| Molecular Weight | 240.24 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 1H-indazole;sulfonylurea |
| SMILES | NC(=O)N=S(=O)=O.c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C7H6N2.CH2N2O3S/c1-2-4-7-6(3-1)5-8-9-7;2-1(4)3-7(5)6/h1-5H,(H,8,9);(H2,2,4) |
| InChIKey | HBYBJAZKBJLNIC-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 118.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.24 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1H-indazole;sulfonylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indazole;sulfonylurea?
The IUPAC name of 1H-indazole;sulfonylurea (CID 158433470) is 1H-indazole;sulfonylurea.
What is the SMILES notation for 1H-indazole;sulfonylurea?
The canonical SMILES for 1H-indazole;sulfonylurea is NC(=O)N=S(=O)=O.c1ccc2[nH]ncc2c1.
What is the InChIKey of 1H-indazole;sulfonylurea?
The InChIKey is HBYBJAZKBJLNIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.CH2N2O3S/c1-2-4-7-6(3-1)5-8-9-7;2-1(4)3-7(5)6/h1-5H,(H,8,9);(H2,2,4).
What are the key properties of 1H-indazole;sulfonylurea?
1H-indazole;sulfonylurea has a molecular weight of 240.24 g/mol, XLogP of 0.69, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indazole;sulfonylurea is sourced from PubChem (CID 158433470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).