About 1H-indazole;quinoline
1H-indazole;quinoline (PubChem CID 67837536) has the molecular formula C16H13N3
and a molecular weight of 247.30 g/mol. Its IUPAC name is 1H-indazole;quinoline.
Molecular Properties
| Compound Name | 1H-indazole;quinoline |
| PubChem CID | 67837536 |
| Molecular Formula | C16H13N3 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 1H-indazole;quinoline |
| SMILES | c1ccc2[nH]ncc2c1.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C7H6N2/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-4-7-6(3-1)5-8-9-7/h1-7H;1-5H,(H,8,9) |
| InChIKey | AMODFWGMOQRQSH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-indazole;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indazole;quinoline?
The IUPAC name of 1H-indazole;quinoline (CID 67837536) is 1H-indazole;quinoline.
What is the SMILES notation for 1H-indazole;quinoline?
The canonical SMILES for 1H-indazole;quinoline is c1ccc2[nH]ncc2c1.c1ccc2ncccc2c1.
What is the InChIKey of 1H-indazole;quinoline?
The InChIKey is AMODFWGMOQRQSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C7H6N2/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-4-7-6(3-1)5-8-9-7/h1-7H;1-5H,(H,8,9).
What are the key properties of 1H-indazole;quinoline?
1H-indazole;quinoline has a molecular weight of 247.30 g/mol, XLogP of 3.80, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indazole;quinoline is sourced from PubChem (CID 67837536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).