About ethane;5-methyl-1H-indazole
ethane;5-methyl-1H-indazole (PubChem CID 178026047) has the molecular formula C14H26N2
and a molecular weight of 222.38 g/mol. Its IUPAC name is ethane;5-methyl-1H-indazole.
Molecular Properties
| Compound Name | ethane;5-methyl-1H-indazole |
| PubChem CID | 178026047 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | ethane;5-methyl-1H-indazole |
| SMILES | CC.CC.CC.Cc1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C8H8N2.3C2H6/c1-6-2-3-8-7(4-6)5-9-10-8;3*1-2/h2-5H,1H3,(H,9,10);3*1-2H3 |
| InChIKey | WZSADTFYNDQABE-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;5-methyl-1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-methyl-1H-indazole?
The IUPAC name of ethane;5-methyl-1H-indazole (CID 178026047) is ethane;5-methyl-1H-indazole.
What is the SMILES notation for ethane;5-methyl-1H-indazole?
The canonical SMILES for ethane;5-methyl-1H-indazole is CC.CC.CC.Cc1ccc2[nH]ncc2c1.
What is the InChIKey of ethane;5-methyl-1H-indazole?
The InChIKey is WZSADTFYNDQABE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2.3C2H6/c1-6-2-3-8-7(4-6)5-9-10-8;3*1-2/h2-5H,1H3,(H,9,10);3*1-2H3.
What are the key properties of ethane;5-methyl-1H-indazole?
ethane;5-methyl-1H-indazole has a molecular weight of 222.38 g/mol, XLogP of 4.95, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-methyl-1H-indazole is sourced from PubChem (CID 178026047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).