About 1H-indazole-5-thiolate
1H-indazole-5-thiolate (PubChem CID 51922109) has the molecular formula C7H5N2S-
and a molecular weight of 149.20 g/mol. Its IUPAC name is 1H-indazole-5-thiolate.
Molecular Properties
| Compound Name | 1H-indazole-5-thiolate |
| PubChem CID | 51922109 |
| Molecular Formula | C7H5N2S- |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.02 |
| IUPAC Name | 1H-indazole-5-thiolate |
| SMILES | [S-]c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C7H6N2S/c10-6-1-2-7-5(3-6)4-8-9-7/h1-4,10H,(H,8,9)/p-1 |
| InChIKey | ZISLUPNINLZWRT-UHFFFAOYSA-M |
| XLogP | 1.47 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze 1H-indazole-5-thiolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indazole-5-thiolate?
The IUPAC name of 1H-indazole-5-thiolate (CID 51922109) is 1H-indazole-5-thiolate.
What is the SMILES notation for 1H-indazole-5-thiolate?
The canonical SMILES for 1H-indazole-5-thiolate is [S-]c1ccc2[nH]ncc2c1.
What is the InChIKey of 1H-indazole-5-thiolate?
The InChIKey is ZISLUPNINLZWRT-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H6N2S/c10-6-1-2-7-5(3-6)4-8-9-7/h1-4,10H,(H,8,9)/p-1.
What are the key properties of 1H-indazole-5-thiolate?
1H-indazole-5-thiolate has a molecular weight of 149.20 g/mol, XLogP of 1.47, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indazole-5-thiolate is sourced from PubChem (CID 51922109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).