About 1H-indazol-5-amine;5-methyl-1H-indazole
1H-indazol-5-amine;5-methyl-1H-indazole (PubChem CID 159974362) has the molecular formula C15H15N5
and a molecular weight of 265.32 g/mol. Its IUPAC name is 1H-indazol-5-amine;5-methyl-1H-indazole.
Molecular Properties
| Compound Name | 1H-indazol-5-amine;5-methyl-1H-indazole |
| PubChem CID | 159974362 |
| Molecular Formula | C15H15N5 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 1H-indazol-5-amine;5-methyl-1H-indazole |
| SMILES | Cc1ccc2[nH]ncc2c1.Nc1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C8H8N2.C7H7N3/c1-6-2-3-8-7(4-6)5-9-10-8;8-6-1-2-7-5(3-6)4-9-10-7/h2-5H,1H3,(H,9,10);1-4H,8H2,(H,9,10) |
| InChIKey | OEYOJZJFLXUXNX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1H-indazol-5-amine;5-methyl-1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indazol-5-amine;5-methyl-1H-indazole?
The IUPAC name of 1H-indazol-5-amine;5-methyl-1H-indazole (CID 159974362) is 1H-indazol-5-amine;5-methyl-1H-indazole.
What is the SMILES notation for 1H-indazol-5-amine;5-methyl-1H-indazole?
The canonical SMILES for 1H-indazol-5-amine;5-methyl-1H-indazole is Cc1ccc2[nH]ncc2c1.Nc1ccc2[nH]ncc2c1.
What is the InChIKey of 1H-indazol-5-amine;5-methyl-1H-indazole?
The InChIKey is OEYOJZJFLXUXNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2.C7H7N3/c1-6-2-3-8-7(4-6)5-9-10-8;8-6-1-2-7-5(3-6)4-9-10-7/h2-5H,1H3,(H,9,10);1-4H,8H2,(H,9,10).
What are the key properties of 1H-indazol-5-amine;5-methyl-1H-indazole?
1H-indazol-5-amine;5-methyl-1H-indazole has a molecular weight of 265.32 g/mol, XLogP of 3.02, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indazol-5-amine;5-methyl-1H-indazole is sourced from PubChem (CID 159974362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).