C21H24N4 — CID 143703747
1-[(4-ethynylphenyl)methyl]piperidine;1H-indazol-5-amine (PubChem CID 143703747) has the molecular formula C21H24N4 and a molecular weight of 332.45 g/mol. Its IUPAC name is 1-[(4-ethynylphenyl)methyl]piperidine;1H-indazol-5-amine.
| Compound Name | 1-[(4-ethynylphenyl)methyl]piperidine;1H-indazol-5-amine |
|---|---|
| PubChem CID | 143703747 |
| Molecular Formula | C21H24N4 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 1-[(4-ethynylphenyl)methyl]piperidine;1H-indazol-5-amine |
| SMILES | C#Cc1ccc(CN2CCCCC2)cc1.Nc1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C14H17N.C7H7N3/c1-2-13-6-8-14(9-7-13)12-15-10-4-3-5-11-15;8-6-1-2-7-5(3-6)4-9-10-7/h1,6-9H,3-5,10-12H2;1-4H,8H2,(H,9,10) |
| InChIKey | MFGGJPOKYZHLAO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|