About 6-methyl-1H-indazole;molecular hydrogen
6-methyl-1H-indazole;molecular hydrogen (PubChem CID 142103069) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is 6-methyl-1H-indazole;molecular hydrogen.
Molecular Properties
| Compound Name | 6-methyl-1H-indazole;molecular hydrogen |
| PubChem CID | 142103069 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 6-methyl-1H-indazole;molecular hydrogen |
| SMILES | Cc1ccc2cn[nH]c2c1.[H][H] |
| InChI | InChI=1S/C8H8N2.H2/c1-6-2-3-7-5-9-10-8(7)4-6;/h2-5H,1H3,(H,9,10);1H |
| InChIKey | BVJAPJNVKMKOOK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-methyl-1H-indazole;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-1H-indazole;molecular hydrogen?
The IUPAC name of 6-methyl-1H-indazole;molecular hydrogen (CID 142103069) is 6-methyl-1H-indazole;molecular hydrogen.
What is the SMILES notation for 6-methyl-1H-indazole;molecular hydrogen?
The canonical SMILES for 6-methyl-1H-indazole;molecular hydrogen is Cc1ccc2cn[nH]c2c1.[H][H].
What is the InChIKey of 6-methyl-1H-indazole;molecular hydrogen?
The InChIKey is BVJAPJNVKMKOOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2.H2/c1-6-2-3-7-5-9-10-8(7)4-6;/h2-5H,1H3,(H,9,10);1H.
What are the key properties of 6-methyl-1H-indazole;molecular hydrogen?
6-methyl-1H-indazole;molecular hydrogen has a molecular weight of 134.18 g/mol, XLogP of 2.12, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-1H-indazole;molecular hydrogen is sourced from PubChem (CID 142103069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).