C11H9NO — CID 91665983
1,3-dihydrofuro[3,4-g]isoquinoline (PubChem CID 91665983) has the molecular formula C11H9NO and a molecular weight of 171.20 g/mol. Its IUPAC name is 1,3-dihydrofuro[3,4-g]isoquinoline.
| Compound Name | 1,3-dihydrofuro[3,4-g]isoquinoline |
|---|---|
| PubChem CID | 91665983 |
| Molecular Formula | C11H9NO |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | 1,3-dihydrofuro[3,4-g]isoquinoline |
| SMILES | c1cc2cc3c(cc2cn1)COC3 |
| InChI | InChI=1S/C11H9NO/c1-2-12-5-9-4-11-7-13-6-10(11)3-8(1)9/h1-5H,6-7H2 |
| InChIKey | NJUZLTFBKVUARZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |