C12H9NO — CID 146627187
2H-pyrano[3,2-g]isoquinoline (PubChem CID 146627187) has the molecular formula C12H9NO and a molecular weight of 183.21 g/mol. Its IUPAC name is 2H-pyrano[3,2-g]isoquinoline.
| Compound Name | 2H-pyrano[3,2-g]isoquinoline |
|---|---|
| PubChem CID | 146627187 |
| Molecular Formula | C12H9NO |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | 2H-pyrano[3,2-g]isoquinoline |
| SMILES | C1=Cc2cc3ccncc3cc2OC1 |
| InChI | InChI=1S/C12H9NO/c1-2-10-6-9-3-4-13-8-11(9)7-12(10)14-5-1/h1-4,6-8H,5H2 |
| InChIKey | YUUULYOMNZYSRY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |