About methanol;6-methoxyisoquinoline;4-methylphenol
methanol;6-methoxyisoquinoline;4-methylphenol (PubChem CID 143309135) has the molecular formula C18H21NO3
and a molecular weight of 299.37 g/mol. Its IUPAC name is methanol;6-methoxyisoquinoline;4-methylphenol.
Molecular Properties
| Compound Name | methanol;6-methoxyisoquinoline;4-methylphenol |
| PubChem CID | 143309135 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | methanol;6-methoxyisoquinoline;4-methylphenol |
| SMILES | CO.COc1ccc2cnccc2c1.Cc1ccc(O)cc1 |
| InChI | InChI=1S/C10H9NO.C7H8O.CH4O/c1-12-10-3-2-9-7-11-5-4-8(9)6-10;1-6-2-4-7(8)5-3-6;1-2/h2-7H,1H3;2-5,8H,1H3;2H,1H3 |
| InChIKey | DPWBMCOBWONSGI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methanol;6-methoxyisoquinoline;4-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;6-methoxyisoquinoline;4-methylphenol?
The IUPAC name of methanol;6-methoxyisoquinoline;4-methylphenol (CID 143309135) is methanol;6-methoxyisoquinoline;4-methylphenol.
What is the SMILES notation for methanol;6-methoxyisoquinoline;4-methylphenol?
The canonical SMILES for methanol;6-methoxyisoquinoline;4-methylphenol is CO.COc1ccc2cnccc2c1.Cc1ccc(O)cc1.
What is the InChIKey of methanol;6-methoxyisoquinoline;4-methylphenol?
The InChIKey is DPWBMCOBWONSGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO.C7H8O.CH4O/c1-12-10-3-2-9-7-11-5-4-8(9)6-10;1-6-2-4-7(8)5-3-6;1-2/h2-7H,1H3;2-5,8H,1H3;2H,1H3.
What are the key properties of methanol;6-methoxyisoquinoline;4-methylphenol?
methanol;6-methoxyisoquinoline;4-methylphenol has a molecular weight of 299.37 g/mol, XLogP of 3.55, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;6-methoxyisoquinoline;4-methylphenol is sourced from PubChem (CID 143309135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).