About isoquinolin-6-yl methyl carbonate
isoquinolin-6-yl methyl carbonate (PubChem CID 22364569) has the molecular formula C11H9NO3
and a molecular weight of 203.20 g/mol. Its IUPAC name is isoquinolin-6-yl methyl carbonate.
Molecular Properties
| Compound Name | isoquinolin-6-yl methyl carbonate |
| PubChem CID | 22364569 |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | isoquinolin-6-yl methyl carbonate |
| SMILES | COC(=O)Oc1ccc2cnccc2c1 |
| InChI | InChI=1S/C11H9NO3/c1-14-11(13)15-10-3-2-9-7-12-5-4-8(9)6-10/h2-7H,1H3 |
| InChIKey | YBNVZBBLMQJNEZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze isoquinolin-6-yl methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isoquinolin-6-yl methyl carbonate?
The IUPAC name of isoquinolin-6-yl methyl carbonate (CID 22364569) is isoquinolin-6-yl methyl carbonate.
What is the SMILES notation for isoquinolin-6-yl methyl carbonate?
The canonical SMILES for isoquinolin-6-yl methyl carbonate is COC(=O)Oc1ccc2cnccc2c1.
What is the InChIKey of isoquinolin-6-yl methyl carbonate?
The InChIKey is YBNVZBBLMQJNEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO3/c1-14-11(13)15-10-3-2-9-7-12-5-4-8(9)6-10/h2-7H,1H3.
What are the key properties of isoquinolin-6-yl methyl carbonate?
isoquinolin-6-yl methyl carbonate has a molecular weight of 203.20 g/mol, XLogP of 2.38, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for isoquinolin-6-yl methyl carbonate is sourced from PubChem (CID 22364569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).