About 1-methoxy-4-methylbenzene;phenol
1-methoxy-4-methylbenzene;phenol (PubChem CID 167630836) has the molecular formula C14H16O2
and a molecular weight of 216.28 g/mol. Its IUPAC name is 1-methoxy-4-methylbenzene;phenol.
Molecular Properties
| Compound Name | 1-methoxy-4-methylbenzene;phenol |
| PubChem CID | 167630836 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 1-methoxy-4-methylbenzene;phenol |
| SMILES | COc1ccc(C)cc1.Oc1ccccc1 |
| InChI | InChI=1S/C8H10O.C6H6O/c1-7-3-5-8(9-2)6-4-7;7-6-4-2-1-3-5-6/h3-6H,1-2H3;1-5,7H |
| InChIKey | NTTPWRJTIQSJBE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methoxy-4-methylbenzene;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-4-methylbenzene;phenol?
The IUPAC name of 1-methoxy-4-methylbenzene;phenol (CID 167630836) is 1-methoxy-4-methylbenzene;phenol.
What is the SMILES notation for 1-methoxy-4-methylbenzene;phenol?
The canonical SMILES for 1-methoxy-4-methylbenzene;phenol is COc1ccc(C)cc1.Oc1ccccc1.
What is the InChIKey of 1-methoxy-4-methylbenzene;phenol?
The InChIKey is NTTPWRJTIQSJBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O.C6H6O/c1-7-3-5-8(9-2)6-4-7;7-6-4-2-1-3-5-6/h3-6H,1-2H3;1-5,7H.
What are the key properties of 1-methoxy-4-methylbenzene;phenol?
1-methoxy-4-methylbenzene;phenol has a molecular weight of 216.28 g/mol, XLogP of 3.40, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-4-methylbenzene;phenol is sourced from PubChem (CID 167630836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).