C14H14Cl2O — CID 158750380
1,2-dichlorobenzene;1-methoxy-4-methylbenzene (PubChem CID 158750380) has the molecular formula C14H14Cl2O and a molecular weight of 269.17 g/mol. Its IUPAC name is 1,2-dichlorobenzene;1-methoxy-4-methylbenzene.
| Compound Name | 1,2-dichlorobenzene;1-methoxy-4-methylbenzene |
|---|---|
| PubChem CID | 158750380 |
| Molecular Formula | C14H14Cl2O |
| Molecular Weight | 269.17 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 1,2-dichlorobenzene;1-methoxy-4-methylbenzene |
| SMILES | COc1ccc(C)cc1.Clc1ccccc1Cl |
| InChI | InChI=1S/C8H10O.C6H4Cl2/c1-7-3-5-8(9-2)6-4-7;7-5-3-1-2-4-6(5)8/h3-6H,1-2H3;1-4H |
| InChIKey | INKCDCVLDDUQRF-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.17 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |