About (Z)-but-2-ene;1-methoxy-4-methylbenzene
(Z)-but-2-ene;1-methoxy-4-methylbenzene (PubChem CID 143799535) has the molecular formula C12H18O
and a molecular weight of 178.28 g/mol. Its IUPAC name is (Z)-but-2-ene;1-methoxy-4-methylbenzene.
Molecular Properties
| Compound Name | (Z)-but-2-ene;1-methoxy-4-methylbenzene |
| PubChem CID | 143799535 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (Z)-but-2-ene;1-methoxy-4-methylbenzene |
| SMILES | C/C=C\C.COc1ccc(C)cc1 |
| InChI | InChI=1S/C8H10O.C4H8/c1-7-3-5-8(9-2)6-4-7;1-3-4-2/h3-6H,1-2H3;3-4H,1-2H3/b;4-3- |
| InChIKey | FCROECNIHARLQU-QGAMPUOQSA-N |
| XLogP | 3.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-ene;1-methoxy-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-ene;1-methoxy-4-methylbenzene?
The IUPAC name of (Z)-but-2-ene;1-methoxy-4-methylbenzene (CID 143799535) is (Z)-but-2-ene;1-methoxy-4-methylbenzene.
What is the SMILES notation for (Z)-but-2-ene;1-methoxy-4-methylbenzene?
The canonical SMILES for (Z)-but-2-ene;1-methoxy-4-methylbenzene is C/C=C\C.COc1ccc(C)cc1.
What is the InChIKey of (Z)-but-2-ene;1-methoxy-4-methylbenzene?
The InChIKey is FCROECNIHARLQU-QGAMPUOQSA-N. The full InChI is InChI=1S/C8H10O.C4H8/c1-7-3-5-8(9-2)6-4-7;1-3-4-2/h3-6H,1-2H3;3-4H,1-2H3/b;4-3-.
What are the key properties of (Z)-but-2-ene;1-methoxy-4-methylbenzene?
(Z)-but-2-ene;1-methoxy-4-methylbenzene has a molecular weight of 178.28 g/mol, XLogP of 3.59, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-ene;1-methoxy-4-methylbenzene is sourced from PubChem (CID 143799535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).