About 1-chloro-2-fluorobenzene;ethane;1-methoxy-4-methylbenzene
1-chloro-2-fluorobenzene;ethane;1-methoxy-4-methylbenzene (PubChem CID 177181155) has the molecular formula C16H20ClFO
and a molecular weight of 282.79 g/mol. Its IUPAC name is 1-chloro-2-fluorobenzene;ethane;1-methoxy-4-methylbenzene.
Molecular Properties
| Compound Name | 1-chloro-2-fluorobenzene;ethane;1-methoxy-4-methylbenzene |
| PubChem CID | 177181155 |
| Molecular Formula | C16H20ClFO |
| Molecular Weight | 282.79 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 1-chloro-2-fluorobenzene;ethane;1-methoxy-4-methylbenzene |
| SMILES | CC.COc1ccc(C)cc1.Fc1ccccc1Cl |
| InChI | InChI=1S/C8H10O.C6H4ClF.C2H6/c1-7-3-5-8(9-2)6-4-7;7-5-3-1-2-4-6(5)8;1-2/h3-6H,1-2H3;1-4H;1-2H3 |
| InChIKey | FMTGPDDKIIINSX-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.79 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-chloro-2-fluorobenzene;ethane;1-methoxy-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-fluorobenzene;ethane;1-methoxy-4-methylbenzene?
The IUPAC name of 1-chloro-2-fluorobenzene;ethane;1-methoxy-4-methylbenzene (CID 177181155) is 1-chloro-2-fluorobenzene;ethane;1-methoxy-4-methylbenzene.
What is the SMILES notation for 1-chloro-2-fluorobenzene;ethane;1-methoxy-4-methylbenzene?
The canonical SMILES for 1-chloro-2-fluorobenzene;ethane;1-methoxy-4-methylbenzene is CC.COc1ccc(C)cc1.Fc1ccccc1Cl.
What is the InChIKey of 1-chloro-2-fluorobenzene;ethane;1-methoxy-4-methylbenzene?
The InChIKey is FMTGPDDKIIINSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O.C6H4ClF.C2H6/c1-7-3-5-8(9-2)6-4-7;7-5-3-1-2-4-6(5)8;1-2/h3-6H,1-2H3;1-4H;1-2H3.
What are the key properties of 1-chloro-2-fluorobenzene;ethane;1-methoxy-4-methylbenzene?
1-chloro-2-fluorobenzene;ethane;1-methoxy-4-methylbenzene has a molecular weight of 282.79 g/mol, XLogP of 5.51, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-fluorobenzene;ethane;1-methoxy-4-methylbenzene is sourced from PubChem (CID 177181155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).