About but-1-yne;1-methoxy-4-methylbenzene;toluene
but-1-yne;1-methoxy-4-methylbenzene;toluene (PubChem CID 161112740) has the molecular formula C19H24O
and a molecular weight of 268.40 g/mol. Its IUPAC name is but-1-yne;1-methoxy-4-methylbenzene;toluene.
Molecular Properties
| Compound Name | but-1-yne;1-methoxy-4-methylbenzene;toluene |
| PubChem CID | 161112740 |
| Molecular Formula | C19H24O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | but-1-yne;1-methoxy-4-methylbenzene;toluene |
| SMILES | C#CCC.COc1ccc(C)cc1.Cc1ccccc1 |
| InChI | InChI=1S/C8H10O.C7H8.C4H6/c1-7-3-5-8(9-2)6-4-7;1-7-5-3-2-4-6-7;1-3-4-2/h3-6H,1-2H3;2-6H,1H3;1H,4H2,2H3 |
| InChIKey | UJXJXIGEIJYENS-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze but-1-yne;1-methoxy-4-methylbenzene;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-yne;1-methoxy-4-methylbenzene;toluene?
The IUPAC name of but-1-yne;1-methoxy-4-methylbenzene;toluene (CID 161112740) is but-1-yne;1-methoxy-4-methylbenzene;toluene.
What is the SMILES notation for but-1-yne;1-methoxy-4-methylbenzene;toluene?
The canonical SMILES for but-1-yne;1-methoxy-4-methylbenzene;toluene is C#CCC.COc1ccc(C)cc1.Cc1ccccc1.
What is the InChIKey of but-1-yne;1-methoxy-4-methylbenzene;toluene?
The InChIKey is UJXJXIGEIJYENS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O.C7H8.C4H6/c1-7-3-5-8(9-2)6-4-7;1-7-5-3-2-4-6-7;1-3-4-2/h3-6H,1-2H3;2-6H,1H3;1H,4H2,2H3.
What are the key properties of but-1-yne;1-methoxy-4-methylbenzene;toluene?
but-1-yne;1-methoxy-4-methylbenzene;toluene has a molecular weight of 268.40 g/mol, XLogP of 5.03, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-yne;1-methoxy-4-methylbenzene;toluene is sourced from PubChem (CID 161112740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).