C10H13NS — CID 144655505
ethane;3-methylthieno[3,4-c]pyridine (PubChem CID 144655505) has the molecular formula C10H13NS and a molecular weight of 179.29 g/mol. Its IUPAC name is ethane;3-methylthieno[3,4-c]pyridine.
| Compound Name | ethane;3-methylthieno[3,4-c]pyridine |
|---|---|
| PubChem CID | 144655505 |
| Molecular Formula | C10H13NS |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | ethane;3-methylthieno[3,4-c]pyridine |
| SMILES | CC.Cc1scc2ccncc12 |
| InChI | InChI=1S/C8H7NS.C2H6/c1-6-8-4-9-3-2-7(8)5-10-6;1-2/h2-5H,1H3;1-2H3 |
| InChIKey | NZNQGLHETOLUBF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |