C12H11N3S — CID 156838859
2-(4,5-dimethylthiophen-3-yl)-3H-imidazo[4,5-c]pyridine (PubChem CID 156838859) has the molecular formula C12H11N3S and a molecular weight of 229.31 g/mol. Its IUPAC name is 2-(4,5-dimethylthiophen-3-yl)-3H-imidazo[4,5-c]pyridine.
| Compound Name | 2-(4,5-dimethylthiophen-3-yl)-3H-imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 156838859 |
| Molecular Formula | C12H11N3S |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 2-(4,5-dimethylthiophen-3-yl)-3H-imidazo[4,5-c]pyridine |
| SMILES | Cc1scc(-c2nc3ccncc3[nH]2)c1C |
| InChI | InChI=1S/C12H11N3S/c1-7-8(2)16-6-9(7)12-14-10-3-4-13-5-11(10)15-12/h3-6H,1-2H3,(H,14,15) |
| InChIKey | FYRNTKLXDCRQIC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |