C11H9N3OS — CID 67896665
4-(3H-imidazo[4,5-c]pyridin-2-yl)-5-methylthiophen-3-ol (PubChem CID 67896665) has the molecular formula C11H9N3OS and a molecular weight of 231.28 g/mol. Its IUPAC name is 4-(3H-imidazo[4,5-c]pyridin-2-yl)-5-methylthiophen-3-ol.
| Compound Name | 4-(3H-imidazo[4,5-c]pyridin-2-yl)-5-methylthiophen-3-ol |
|---|---|
| PubChem CID | 67896665 |
| Molecular Formula | C11H9N3OS |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 4-(3H-imidazo[4,5-c]pyridin-2-yl)-5-methylthiophen-3-ol |
| SMILES | Cc1scc(O)c1-c1nc2ccncc2[nH]1 |
| InChI | InChI=1S/C11H9N3OS/c1-6-10(9(15)5-16-6)11-13-7-2-3-12-4-8(7)14-11/h2-5,15H,1H3,(H,13,14) |
| InChIKey | BSBAPBHBUUSNMO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|