C14H13N3OS — CID 67896732
2-(2-methyl-4-prop-2-enoxythiophen-3-yl)-3H-imidazo[4,5-c]pyridine (PubChem CID 67896732) has the molecular formula C14H13N3OS and a molecular weight of 271.35 g/mol. Its IUPAC name is 2-(2-methyl-4-prop-2-enoxythiophen-3-yl)-3H-imidazo[4,5-c]pyridine.
| Compound Name | 2-(2-methyl-4-prop-2-enoxythiophen-3-yl)-3H-imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 67896732 |
| Molecular Formula | C14H13N3OS |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 2-(2-methyl-4-prop-2-enoxythiophen-3-yl)-3H-imidazo[4,5-c]pyridine |
| SMILES | C=CCOc1csc(C)c1-c1nc2ccncc2[nH]1 |
| InChI | InChI=1S/C14H13N3OS/c1-3-6-18-12-8-19-9(2)13(12)14-16-10-4-5-15-7-11(10)17-14/h3-5,7-8H,1,6H2,2H3,(H,16,17) |
| InChIKey | LZKQQLLLINVJNZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|