C16H15N3OS — CID 19822016
2-(2-methoxy-4-prop-2-enylsulfanylphenyl)-3H-imidazo[4,5-c]pyridine (PubChem CID 19822016) has the molecular formula C16H15N3OS and a molecular weight of 297.38 g/mol. Its IUPAC name is 2-(2-methoxy-4-prop-2-enylsulfanylphenyl)-3H-imidazo[4,5-c]pyridine.
| Compound Name | 2-(2-methoxy-4-prop-2-enylsulfanylphenyl)-3H-imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 19822016 |
| Molecular Formula | C16H15N3OS |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 2-(2-methoxy-4-prop-2-enylsulfanylphenyl)-3H-imidazo[4,5-c]pyridine |
| SMILES | C=CCSc1ccc(-c2nc3ccncc3[nH]2)c(OC)c1 |
| InChI | InChI=1S/C16H15N3OS/c1-3-8-21-11-4-5-12(15(9-11)20-2)16-18-13-6-7-17-10-14(13)19-16/h3-7,9-10H,1,8H2,2H3,(H,18,19) |
| InChIKey | WHMWFFKJWQMFQG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|