About ethyl 2-[4-(3H-imidazo[4,5-c]pyridin-2-yl)-3-methoxyphenyl]sulfanylacetate
ethyl 2-[4-(3H-imidazo[4,5-c]pyridin-2-yl)-3-methoxyphenyl]sulfanylacetate (PubChem CID 19821929) has the molecular formula C17H17N3O3S
and a molecular weight of 343.41 g/mol. Its IUPAC name is ethyl 2-[4-(3H-imidazo[4,5-c]pyridin-2-yl)-3-methoxyphenyl]sulfanylacetate.
Molecular Properties
| Compound Name | ethyl 2-[4-(3H-imidazo[4,5-c]pyridin-2-yl)-3-methoxyphenyl]sulfanylacetate |
| PubChem CID | 19821929 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | ethyl 2-[4-(3H-imidazo[4,5-c]pyridin-2-yl)-3-methoxyphenyl]sulfanylacetate |
| SMILES | CCOC(=O)CSc1ccc(-c2nc3ccncc3[nH]2)c(OC)c1 |
| InChI | InChI=1S/C17H17N3O3S/c1-3-23-16(21)10-24-11-4-5-12(15(8-11)22-2)17-19-13-6-7-18-9-14(13)20-17/h4-9H,3,10H2,1-2H3,(H,19,20) |
| InChIKey | UXCDUWWSFZESBJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-[4-(3H-imidazo[4,5-c]pyridin-2-yl)-3-methoxyphenyl]sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[4-(3H-imidazo[4,5-c]pyridin-2-yl)-3-methoxyphenyl]sulfanylacetate?
The IUPAC name of ethyl 2-[4-(3H-imidazo[4,5-c]pyridin-2-yl)-3-methoxyphenyl]sulfanylacetate (CID 19821929) is ethyl 2-[4-(3H-imidazo[4,5-c]pyridin-2-yl)-3-methoxyphenyl]sulfanylacetate.
What is the SMILES notation for ethyl 2-[4-(3H-imidazo[4,5-c]pyridin-2-yl)-3-methoxyphenyl]sulfanylacetate?
The canonical SMILES for ethyl 2-[4-(3H-imidazo[4,5-c]pyridin-2-yl)-3-methoxyphenyl]sulfanylacetate is CCOC(=O)CSc1ccc(-c2nc3ccncc3[nH]2)c(OC)c1.
What is the InChIKey of ethyl 2-[4-(3H-imidazo[4,5-c]pyridin-2-yl)-3-methoxyphenyl]sulfanylacetate?
The InChIKey is UXCDUWWSFZESBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3O3S/c1-3-23-16(21)10-24-11-4-5-12(15(8-11)22-2)17-19-13-6-7-18-9-14(13)20-17/h4-9H,3,10H2,1-2H3,(H,19,20).
What are the key properties of ethyl 2-[4-(3H-imidazo[4,5-c]pyridin-2-yl)-3-methoxyphenyl]sulfanylacetate?
ethyl 2-[4-(3H-imidazo[4,5-c]pyridin-2-yl)-3-methoxyphenyl]sulfanylacetate has a molecular weight of 343.41 g/mol, XLogP of 3.29, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[4-(3H-imidazo[4,5-c]pyridin-2-yl)-3-methoxyphenyl]sulfanylacetate is sourced from PubChem (CID 19821929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).