About methyl 2-[4-(3H-imidazo[4,5-c]pyridin-2-yl)-3-methoxyphenoxy]acetate
methyl 2-[4-(3H-imidazo[4,5-c]pyridin-2-yl)-3-methoxyphenoxy]acetate (PubChem CID 19821943) has the molecular formula C16H15N3O4
and a molecular weight of 313.31 g/mol. Its IUPAC name is methyl 2-[4-(3H-imidazo[4,5-c]pyridin-2-yl)-3-methoxyphenoxy]acetate.
Molecular Properties
| Compound Name | methyl 2-[4-(3H-imidazo[4,5-c]pyridin-2-yl)-3-methoxyphenoxy]acetate |
| PubChem CID | 19821943 |
| Molecular Formula | C16H15N3O4 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | methyl 2-[4-(3H-imidazo[4,5-c]pyridin-2-yl)-3-methoxyphenoxy]acetate |
| SMILES | COC(=O)COc1ccc(-c2nc3ccncc3[nH]2)c(OC)c1 |
| InChI | InChI=1S/C16H15N3O4/c1-21-14-7-10(23-9-15(20)22-2)3-4-11(14)16-18-12-5-6-17-8-13(12)19-16/h3-8H,9H2,1-2H3,(H,18,19) |
| InChIKey | LCFIMOOZFYGULQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[4-(3H-imidazo[4,5-c]pyridin-2-yl)-3-methoxyphenoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[4-(3H-imidazo[4,5-c]pyridin-2-yl)-3-methoxyphenoxy]acetate?
The IUPAC name of methyl 2-[4-(3H-imidazo[4,5-c]pyridin-2-yl)-3-methoxyphenoxy]acetate (CID 19821943) is methyl 2-[4-(3H-imidazo[4,5-c]pyridin-2-yl)-3-methoxyphenoxy]acetate.
What is the SMILES notation for methyl 2-[4-(3H-imidazo[4,5-c]pyridin-2-yl)-3-methoxyphenoxy]acetate?
The canonical SMILES for methyl 2-[4-(3H-imidazo[4,5-c]pyridin-2-yl)-3-methoxyphenoxy]acetate is COC(=O)COc1ccc(-c2nc3ccncc3[nH]2)c(OC)c1.
What is the InChIKey of methyl 2-[4-(3H-imidazo[4,5-c]pyridin-2-yl)-3-methoxyphenoxy]acetate?
The InChIKey is LCFIMOOZFYGULQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O4/c1-21-14-7-10(23-9-15(20)22-2)3-4-11(14)16-18-12-5-6-17-8-13(12)19-16/h3-8H,9H2,1-2H3,(H,18,19).
What are the key properties of methyl 2-[4-(3H-imidazo[4,5-c]pyridin-2-yl)-3-methoxyphenoxy]acetate?
methyl 2-[4-(3H-imidazo[4,5-c]pyridin-2-yl)-3-methoxyphenoxy]acetate has a molecular weight of 313.31 g/mol, XLogP of 2.19, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[4-(3H-imidazo[4,5-c]pyridin-2-yl)-3-methoxyphenoxy]acetate is sourced from PubChem (CID 19821943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).