About 2-(3-prop-2-enoxy-4-prop-2-ynoxyphenyl)-3H-imidazo[4,5-c]pyridine
2-(3-prop-2-enoxy-4-prop-2-ynoxyphenyl)-3H-imidazo[4,5-c]pyridine (PubChem CID 19821966) has the molecular formula C18H15N3O2
and a molecular weight of 305.34 g/mol. Its IUPAC name is 2-(3-prop-2-enoxy-4-prop-2-ynoxyphenyl)-3H-imidazo[4,5-c]pyridine.
Molecular Properties
| Compound Name | 2-(3-prop-2-enoxy-4-prop-2-ynoxyphenyl)-3H-imidazo[4,5-c]pyridine |
| PubChem CID | 19821966 |
| Molecular Formula | C18H15N3O2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 2-(3-prop-2-enoxy-4-prop-2-ynoxyphenyl)-3H-imidazo[4,5-c]pyridine |
| SMILES | C#CCOc1ccc(-c2nc3ccncc3[nH]2)cc1OCC=C |
| InChI | InChI=1S/C18H15N3O2/c1-3-9-22-16-6-5-13(11-17(16)23-10-4-2)18-20-14-7-8-19-12-15(14)21-18/h1,4-8,11-12H,2,9-10H2,(H,20,21) |
| InChIKey | UYHLWGSRTWHBOE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-prop-2-enoxy-4-prop-2-ynoxyphenyl)-3H-imidazo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-prop-2-enoxy-4-prop-2-ynoxyphenyl)-3H-imidazo[4,5-c]pyridine?
The IUPAC name of 2-(3-prop-2-enoxy-4-prop-2-ynoxyphenyl)-3H-imidazo[4,5-c]pyridine (CID 19821966) is 2-(3-prop-2-enoxy-4-prop-2-ynoxyphenyl)-3H-imidazo[4,5-c]pyridine.
What is the SMILES notation for 2-(3-prop-2-enoxy-4-prop-2-ynoxyphenyl)-3H-imidazo[4,5-c]pyridine?
The canonical SMILES for 2-(3-prop-2-enoxy-4-prop-2-ynoxyphenyl)-3H-imidazo[4,5-c]pyridine is C#CCOc1ccc(-c2nc3ccncc3[nH]2)cc1OCC=C.
What is the InChIKey of 2-(3-prop-2-enoxy-4-prop-2-ynoxyphenyl)-3H-imidazo[4,5-c]pyridine?
The InChIKey is UYHLWGSRTWHBOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N3O2/c1-3-9-22-16-6-5-13(11-17(16)23-10-4-2)18-20-14-7-8-19-12-15(14)21-18/h1,4-8,11-12H,2,9-10H2,(H,20,21).
What are the key properties of 2-(3-prop-2-enoxy-4-prop-2-ynoxyphenyl)-3H-imidazo[4,5-c]pyridine?
2-(3-prop-2-enoxy-4-prop-2-ynoxyphenyl)-3H-imidazo[4,5-c]pyridine has a molecular weight of 305.34 g/mol, XLogP of 3.20, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-prop-2-enoxy-4-prop-2-ynoxyphenyl)-3H-imidazo[4,5-c]pyridine is sourced from PubChem (CID 19821966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).