C18H13N — CID 134973288
11-methylnaphtho[1,2-h]isoquinoline (PubChem CID 134973288) has the molecular formula C18H13N and a molecular weight of 243.31 g/mol. Its IUPAC name is 11-methylnaphtho[1,2-h]isoquinoline.
| Compound Name | 11-methylnaphtho[1,2-h]isoquinoline |
|---|---|
| PubChem CID | 134973288 |
| Molecular Formula | C18H13N |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 11-methylnaphtho[1,2-h]isoquinoline |
| SMILES | Cc1cc2ccncc2c2ccc3ccccc3c12 |
| InChI | InChI=1S/C18H13N/c1-12-10-14-8-9-19-11-17(14)16-7-6-13-4-2-3-5-15(13)18(12)16/h2-11H,1H3 |
| InChIKey | ZPMXSAMXEDGDQO-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|