C12H11Br — CID 115057574
2-bromo-1,6-dimethylnaphthalene (PubChem CID 115057574) has the molecular formula C12H11Br and a molecular weight of 235.12 g/mol. Its IUPAC name is 2-bromo-1,6-dimethylnaphthalene.
| Compound Name | 2-bromo-1,6-dimethylnaphthalene |
|---|---|
| PubChem CID | 115057574 |
| Molecular Formula | C12H11Br |
| Molecular Weight | 235.12 g/mol |
| Exact Mass | 234.00 |
| IUPAC Name | 2-bromo-1,6-dimethylnaphthalene |
| SMILES | Cc1ccc2c(C)c(Br)ccc2c1 |
| InChI | InChI=1S/C12H11Br/c1-8-3-5-11-9(2)12(13)6-4-10(11)7-8/h3-7H,1-2H3 |
| InChIKey | VEBSFMMXDZKTDZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.12 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |