C11H7BrF2 — CID 174273019
8-bromo-1,2-difluoro-6-methylnaphthalene (PubChem CID 174273019) has the molecular formula C11H7BrF2 and a molecular weight of 257.08 g/mol. Its IUPAC name is 8-bromo-1,2-difluoro-6-methylnaphthalene.
| Compound Name | 8-bromo-1,2-difluoro-6-methylnaphthalene |
|---|---|
| PubChem CID | 174273019 |
| Molecular Formula | C11H7BrF2 |
| Molecular Weight | 257.08 g/mol |
| Exact Mass | 255.97 |
| IUPAC Name | 8-bromo-1,2-difluoro-6-methylnaphthalene |
| SMILES | Cc1cc(Br)c2c(F)c(F)ccc2c1 |
| InChI | InChI=1S/C11H7BrF2/c1-6-4-7-2-3-9(13)11(14)10(7)8(12)5-6/h2-5H,1H3 |
| InChIKey | SVEQWTDUMIJMJG-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.08 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |