C17H10BrF5 — CID 158000312
1-bromo-2,3,4-trifluorobenzene;1,2-difluoro-8-methylnaphthalene (PubChem CID 158000312) has the molecular formula C17H10BrF5 and a molecular weight of 389.16 g/mol. Its IUPAC name is 1-bromo-2,3,4-trifluorobenzene;1,2-difluoro-8-methylnaphthalene.
| Compound Name | 1-bromo-2,3,4-trifluorobenzene;1,2-difluoro-8-methylnaphthalene |
|---|---|
| PubChem CID | 158000312 |
| Molecular Formula | C17H10BrF5 |
| Molecular Weight | 389.16 g/mol |
| Exact Mass | 387.99 |
| IUPAC Name | 1-bromo-2,3,4-trifluorobenzene;1,2-difluoro-8-methylnaphthalene |
| SMILES | Cc1cccc2ccc(F)c(F)c12.Fc1ccc(Br)c(F)c1F |
| InChI | InChI=1S/C11H8F2.C6H2BrF3/c1-7-3-2-4-8-5-6-9(12)11(13)10(7)8;7-3-1-2-4(8)6(10)5(3)9/h2-6H,1H3;1-2H |
| InChIKey | FDQQVUSKXLBNPV-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.16 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|