C42H28 — CID 157412879
2-methylperylene;3-methylperylene (PubChem CID 157412879) has the molecular formula C42H28 and a molecular weight of 532.69 g/mol. Its IUPAC name is 2-methylperylene;3-methylperylene.
| Compound Name | 2-methylperylene;3-methylperylene |
|---|---|
| PubChem CID | 157412879 |
| Molecular Formula | C42H28 |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | 2-methylperylene;3-methylperylene |
| SMILES | Cc1cc2cccc3c4cccc5cccc(c(c1)c23)c54.Cc1ccc2c3cccc4cccc(c5cccc1c52)c43 |
| InChI | InChI=1S/2C21H14/c1-13-11-15-7-4-9-17-16-8-2-5-14-6-3-10-18(20(14)16)19(12-13)21(15)17;1-13-11-12-19-17-9-3-6-14-5-2-8-16(20(14)17)18-10-4-7-15(13)21(18)19/h2*2-12H,1H3 |
| InChIKey | BOMLKLIWFYFOMQ-UHFFFAOYSA-N |
| XLogP | 12.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 12.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|